C23H23ClN6O4 — CID 90985319
[3-[2-chloro-4-[[5-[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-yl]amino]phenoxy]phenyl]urea (PubChem CID 90985319) has the molecular formula C23H23ClN6O4 and a molecular weight of 482.93 g/mol. Its IUPAC name is [3-[2-chloro-4-[[5-[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-yl]amino]phenoxy]phenyl]urea.
| Compound Name | [3-[2-chloro-4-[[5-[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-yl]amino]phenoxy]phenyl]urea |
|---|---|
| PubChem CID | 90985319 |
| Molecular Formula | C23H23ClN6O4 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [3-[2-chloro-4-[[5-[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-yl]amino]phenoxy]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(Oc2ccc(Nc3ncnc4ccn(CCOCCO)c34)cc2Cl)c1 |
| InChI | InChI=1S/C23H23ClN6O4/c24-18-13-16(4-5-20(18)34-17-3-1-2-15(12-17)29-23(25)32)28-22-21-19(26-14-27-22)6-7-30(21)8-10-33-11-9-31/h1-7,12-14,31H,8-11H2,(H3,25,29,32)(H,26,27,28) |
| InChIKey | SGFXRENKZCDHOG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|