C27H30ClN4O5+ — CID 149085684
2-[2-[4-[3-chloro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyloxidanium (PubChem CID 149085684) has the molecular formula C27H30ClN4O5+ and a molecular weight of 526.01 g/mol. Its IUPAC name is 2-[2-[4-[3-chloro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyloxidanium.
| Compound Name | 2-[2-[4-[3-chloro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyloxidanium |
|---|---|
| PubChem CID | 149085684 |
| Molecular Formula | C27H30ClN4O5+ |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[2-[4-[3-chloro-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethyloxidanium |
| SMILES | CC(C)(C)OC(=O)c1ccc(Oc2ccc(Nc3ncnc4ccn(CCOCC[OH2+])c34)cc2Cl)cc1 |
| InChI | InChI=1S/C27H29ClN4O5/c1-27(2,3)37-26(34)18-4-7-20(8-5-18)36-23-9-6-19(16-21(23)28)31-25-24-22(29-17-30-25)10-11-32(24)12-14-35-15-13-33/h4-11,16-17,33H,12-15H2,1-3H3,(H,29,30,31)/p+1 |
| InChIKey | QREZURGZAMPPQG-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|