C25H18BrN5O5 — CID 69160525
4-[3-bromo-5-(1,3-oxazol-5-yl)phenyl]-2-[5-(2-hydroxyethylamino)-2-nitrophenyl]phthalazin-1-one (PubChem CID 69160525) has the molecular formula C25H18BrN5O5 and a molecular weight of 548.35 g/mol. Its IUPAC name is 4-[3-bromo-5-(1,3-oxazol-5-yl)phenyl]-2-[5-(2-hydroxyethylamino)-2-nitrophenyl]phthalazin-1-one.
| Compound Name | 4-[3-bromo-5-(1,3-oxazol-5-yl)phenyl]-2-[5-(2-hydroxyethylamino)-2-nitrophenyl]phthalazin-1-one |
|---|---|
| PubChem CID | 69160525 |
| Molecular Formula | C25H18BrN5O5 |
| Molecular Weight | 548.35 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | 4-[3-bromo-5-(1,3-oxazol-5-yl)phenyl]-2-[5-(2-hydroxyethylamino)-2-nitrophenyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2cc(Br)cc(-c3cnco3)c2)nn1-c1cc(NCCO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18BrN5O5/c26-17-10-15(23-13-27-14-36-23)9-16(11-17)24-19-3-1-2-4-20(19)25(33)30(29-24)22-12-18(28-7-8-32)5-6-21(22)31(34)35/h1-6,9-14,28,32H,7-8H2 |
| InChIKey | VBRMPDIKIYMJEU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|