C26H22N6O5 — CID 69162231
3-[5-(3-hydroxypropylamino)-2-nitrophenyl]-1-[3-methyl-5-(1,3-oxazol-5-yl)phenyl]pyrido[3,4-d]pyridazin-4-one (PubChem CID 69162231) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is 3-[5-(3-hydroxypropylamino)-2-nitrophenyl]-1-[3-methyl-5-(1,3-oxazol-5-yl)phenyl]pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 3-[5-(3-hydroxypropylamino)-2-nitrophenyl]-1-[3-methyl-5-(1,3-oxazol-5-yl)phenyl]pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 69162231 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-[5-(3-hydroxypropylamino)-2-nitrophenyl]-1-[3-methyl-5-(1,3-oxazol-5-yl)phenyl]pyrido[3,4-d]pyridazin-4-one |
| SMILES | Cc1cc(-c2cnco2)cc(-c2nn(-c3cc(NCCCO)ccc3[N+](=O)[O-])c(=O)c3cnccc23)c1 |
| InChI | InChI=1S/C26H22N6O5/c1-16-9-17(24-14-28-15-37-24)11-18(10-16)25-20-5-7-27-13-21(20)26(34)31(30-25)23-12-19(29-6-2-8-33)3-4-22(23)32(35)36/h3-5,7,9-15,29,33H,2,6,8H2,1H3 |
| InChIKey | ALMAAYMNJWGKAW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|