C17H11Br2NO2 — CID 69166659
5,7-dibromo-1-(3-phenylprop-2-enyl)indole-2,3-dione (PubChem CID 69166659) has the molecular formula C17H11Br2NO2 and a molecular weight of 421.09 g/mol. Its IUPAC name is 5,7-dibromo-1-(3-phenylprop-2-enyl)indole-2,3-dione.
| Compound Name | 5,7-dibromo-1-(3-phenylprop-2-enyl)indole-2,3-dione |
|---|---|
| PubChem CID | 69166659 |
| Molecular Formula | C17H11Br2NO2 |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | 5,7-dibromo-1-(3-phenylprop-2-enyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC=Cc2ccccc2)c2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C17H11Br2NO2/c18-12-9-13-15(14(19)10-12)20(17(22)16(13)21)8-4-7-11-5-2-1-3-6-11/h1-7,9-10H,8H2 |
| InChIKey | RCOOJYSKHVRBDN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|