C31H51NO9Si — CID 69175140
tert-butyl 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoyl]oxypropanoyloxy]-3-methylpentanoate (PubChem CID 69175140) has the molecular formula C31H51NO9Si and a molecular weight of 609.83 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoyl]oxypropanoyloxy]-3-methylpentanoate.
| Compound Name | tert-butyl 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoyl]oxypropanoyloxy]-3-methylpentanoate |
|---|---|
| PubChem CID | 69175140 |
| Molecular Formula | C31H51NO9Si |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | tert-butyl 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoyl]oxypropanoyloxy]-3-methylpentanoate |
| SMILES | CCC(C)C(OC(=O)C(C)OC(=O)C(NC(=O)OCc1ccccc1)C(C)O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H51NO9Si/c1-13-20(2)25(28(35)40-30(5,6)7)39-26(33)22(4)38-27(34)24(21(3)41-42(11,12)31(8,9)10)32-29(36)37-19-23-17-15-14-16-18-23/h14-18,20-22,24-25H,13,19H2,1-12H3,(H,32,36) |
| InChIKey | ULNZTIQRJKHSOH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|