C33H39N3O8S — CID 69176394
ethyl (2S)-3-[4-[2-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)-(4-nitrophenyl)sulfonylamino]ethoxy]phenyl]-2-ethoxypropanoate (PubChem CID 69176394) has the molecular formula C33H39N3O8S and a molecular weight of 637.75 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[2-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)-(4-nitrophenyl)sulfonylamino]ethoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl (2S)-3-[4-[2-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)-(4-nitrophenyl)sulfonylamino]ethoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 69176394 |
| Molecular Formula | C33H39N3O8S |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | ethyl (2S)-3-[4-[2-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)-(4-nitrophenyl)sulfonylamino]ethoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCN(C2C3CN(Cc4ccccc4)CC32)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)OCC |
| InChI | InChI=1S/C33H39N3O8S/c1-3-42-31(33(37)43-4-2)20-24-10-14-27(15-11-24)44-19-18-35(45(40,41)28-16-12-26(13-17-28)36(38)39)32-29-22-34(23-30(29)32)21-25-8-6-5-7-9-25/h5-17,29-32H,3-4,18-23H2,1-2H3/t29?,30?,31-,32?/m0/s1 |
| InChIKey | DSUCMJXWAQNWBS-UHKXVHSYSA-N |
| XLogP | 4.31 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|