C11H18N2O4 — CID 69181242
1,3-bis(1-methoxyethyl)-6-methylpyrimidine-2,4-dione (PubChem CID 69181242) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1,3-bis(1-methoxyethyl)-6-methylpyrimidine-2,4-dione.
| Compound Name | 1,3-bis(1-methoxyethyl)-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69181242 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,3-bis(1-methoxyethyl)-6-methylpyrimidine-2,4-dione |
| SMILES | COC(C)n1c(C)cc(=O)n(C(C)OC)c1=O |
| InChI | InChI=1S/C11H18N2O4/c1-7-6-10(14)13(9(3)17-5)11(15)12(7)8(2)16-4/h6,8-9H,1-5H3 |
| InChIKey | FLBSRSGLYQJFCV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |