C19H20Cl2N2O5S — CID 69184246
1,2-dichloro-3-[3-(dimethylamino)-2-(4-methoxycarbonyl-N-sulfinoanilino)-3-oxopropyl]benzene (PubChem CID 69184246) has the molecular formula C19H20Cl2N2O5S and a molecular weight of 459.35 g/mol. Its IUPAC name is 1,2-dichloro-3-[3-(dimethylamino)-2-(4-methoxycarbonyl-N-sulfinoanilino)-3-oxopropyl]benzene.
| Compound Name | 1,2-dichloro-3-[3-(dimethylamino)-2-(4-methoxycarbonyl-N-sulfinoanilino)-3-oxopropyl]benzene |
|---|---|
| PubChem CID | 69184246 |
| Molecular Formula | C19H20Cl2N2O5S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 1,2-dichloro-3-[3-(dimethylamino)-2-(4-methoxycarbonyl-N-sulfinoanilino)-3-oxopropyl]benzene |
| SMILES | COC(=O)c1ccc(N(C(Cc2cccc(Cl)c2Cl)C(=O)N(C)C)S(=O)O)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O5S/c1-22(2)18(24)16(11-13-5-4-6-15(20)17(13)21)23(29(26)27)14-9-7-12(8-10-14)19(25)28-3/h4-10,16H,11H2,1-3H3,(H,26,27) |
| InChIKey | BISNBGKCVRMAMC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|