C25H29ClFN3O — CID 69185976
2-[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-methylindol-1-yl]-N,N-dimethylacetamide (PubChem CID 69185976) has the molecular formula C25H29ClFN3O and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-methylindol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-methylindol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 69185976 |
| Molecular Formula | C25H29ClFN3O |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 2-[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-methylindol-1-yl]-N,N-dimethylacetamide |
| SMILES | Cc1c(CN2CCC(c3c(F)cccc3Cl)CC2)c2ccccc2n1CC(=O)N(C)C |
| InChI | InChI=1S/C25H29ClFN3O/c1-17-20(19-7-4-5-10-23(19)30(17)16-24(31)28(2)3)15-29-13-11-18(12-14-29)25-21(26)8-6-9-22(25)27/h4-10,18H,11-16H2,1-3H3 |
| InChIKey | NXYODENHKWGRNV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|