C15H18F2O2 — CID 69186082
(2S)-2-[3-(2,5-difluorophenyl)but-3-en-2-yloxy]oxane (PubChem CID 69186082) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (2S)-2-[3-(2,5-difluorophenyl)but-3-en-2-yloxy]oxane.
| Compound Name | (2S)-2-[3-(2,5-difluorophenyl)but-3-en-2-yloxy]oxane |
|---|---|
| PubChem CID | 69186082 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2S)-2-[3-(2,5-difluorophenyl)but-3-en-2-yloxy]oxane |
| SMILES | C=C(c1cc(F)ccc1F)C(C)O[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H18F2O2/c1-10(13-9-12(16)6-7-14(13)17)11(2)19-15-5-3-4-8-18-15/h6-7,9,11,15H,1,3-5,8H2,2H3/t11?,15-/m0/s1 |
| InChIKey | VFAQNMVHYHWUKR-MHTVFEQDSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |