C32H38N4O — CID 69188818
1-(4-aminobutyl)-1-[[4-[(benzylamino)methyl]phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea (PubChem CID 69188818) has the molecular formula C32H38N4O and a molecular weight of 494.68 g/mol. Its IUPAC name is 1-(4-aminobutyl)-1-[[4-[(benzylamino)methyl]phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea.
| Compound Name | 1-(4-aminobutyl)-1-[[4-[(benzylamino)methyl]phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea |
|---|---|
| PubChem CID | 69188818 |
| Molecular Formula | C32H38N4O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 1-(4-aminobutyl)-1-[[4-[(benzylamino)methyl]phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea |
| SMILES | CC(NC(=O)N(CCCCN)Cc1ccc(CNCc2ccccc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H38N4O/c1-25(30-15-9-13-29-12-5-6-14-31(29)30)35-32(37)36(21-8-7-20-33)24-28-18-16-27(17-19-28)23-34-22-26-10-3-2-4-11-26/h2-6,9-19,25,34H,7-8,20-24,33H2,1H3,(H,35,37) |
| InChIKey | TUDSIISXFRSOKV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|