C32H44N6O2 — CID 71047850
1-(4-aminobutyl)-3-(1-naphthalen-1-ylethyl)-1-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]amino]urea (PubChem CID 71047850) has the molecular formula C32H44N6O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-(1-naphthalen-1-ylethyl)-1-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]amino]urea.
| Compound Name | 1-(4-aminobutyl)-3-(1-naphthalen-1-ylethyl)-1-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 71047850 |
| Molecular Formula | C32H44N6O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 1-(4-aminobutyl)-3-(1-naphthalen-1-ylethyl)-1-[[4-[(4-propan-2-ylpiperazin-1-yl)methyl]benzoyl]amino]urea |
| SMILES | CC(NC(=O)N(CCCCN)NC(=O)c1ccc(CN2CCN(C(C)C)CC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H44N6O2/c1-24(2)37-21-19-36(20-22-37)23-26-13-15-28(16-14-26)31(39)35-38(18-7-6-17-33)32(40)34-25(3)29-12-8-10-27-9-4-5-11-30(27)29/h4-5,8-16,24-25H,6-7,17-23,33H2,1-3H3,(H,34,40)(H,35,39) |
| InChIKey | YYZBRASAUKCNNN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|