C25H24Cl2N4O3S — CID 69192060
N-[3-(1H-benzimidazol-2-yl)propyl]-4-[(2,3-dichlorophenyl)methyl-methylsulfonylamino]benzamide (PubChem CID 69192060) has the molecular formula C25H24Cl2N4O3S and a molecular weight of 531.47 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-4-[(2,3-dichlorophenyl)methyl-methylsulfonylamino]benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-[(2,3-dichlorophenyl)methyl-methylsulfonylamino]benzamide |
|---|---|
| PubChem CID | 69192060 |
| Molecular Formula | C25H24Cl2N4O3S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-[(2,3-dichlorophenyl)methyl-methylsulfonylamino]benzamide |
| SMILES | CS(=O)(=O)N(Cc1cccc(Cl)c1Cl)c1ccc(C(=O)NCCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H24Cl2N4O3S/c1-35(33,34)31(16-18-6-4-7-20(26)24(18)27)19-13-11-17(12-14-19)25(32)28-15-5-10-23-29-21-8-2-3-9-22(21)30-23/h2-4,6-9,11-14H,5,10,15-16H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | CQZHKGHXANKLOT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|