About 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine
1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine (PubChem CID 69192957) has the molecular formula C25H42N4
and a molecular weight of 398.64 g/mol. Its IUPAC name is 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine |
| PubChem CID | 69192957 |
| Molecular Formula | C25H42N4 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.CCc1cc(CC)n(C2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H27N3.C6H15N/c1-3-17-14-18(4-2)22(20-17)19-10-12-21(13-11-19)15-16-8-6-5-7-9-16;1-4-7(5-2)6-3/h5-9,14,19H,3-4,10-13,15H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | PUMACRRPYCJKEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine?
The IUPAC name of 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine (CID 69192957) is 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine.
What is the SMILES notation for 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine?
The canonical SMILES for 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine is CCN(CC)CC.CCc1cc(CC)n(C2CCN(Cc3ccccc3)CC2)n1.
What is the InChIKey of 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine?
The InChIKey is PUMACRRPYCJKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3.C6H15N/c1-3-17-14-18(4-2)22(20-17)19-10-12-21(13-11-19)15-16-8-6-5-7-9-16;1-4-7(5-2)6-3/h5-9,14,19H,3-4,10-13,15H2,1-2H3;4-6H2,1-3H3.
What are the key properties of 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine?
1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine has a molecular weight of 398.64 g/mol, XLogP of 5.19, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine is sourced from PubChem (CID 69192957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).