C25H42N4 — CID 69192957
1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine (PubChem CID 69192957) has the molecular formula C25H42N4 and a molecular weight of 398.64 g/mol. Its IUPAC name is 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine.
| Compound Name | 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine |
|---|---|
| PubChem CID | 69192957 |
| Molecular Formula | C25H42N4 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 1-benzyl-4-(3,5-diethylpyrazol-1-yl)piperidine;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.CCc1cc(CC)n(C2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H27N3.C6H15N/c1-3-17-14-18(4-2)22(20-17)19-10-12-21(13-11-19)15-16-8-6-5-7-9-16;1-4-7(5-2)6-3/h5-9,14,19H,3-4,10-13,15H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | PUMACRRPYCJKEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |