C16H27N5O3S — CID 69193386
1-[2-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)propoxy]ethyl]-2,6-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 69193386) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[2-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)propoxy]ethyl]-2,6-dimethylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[2-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)propoxy]ethyl]-2,6-dimethylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 69193386 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[2-[3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)propoxy]ethyl]-2,6-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc2c(nc(C)n2CCOCCCN2CCCS2(O)O)c(N)n1 |
| InChI | InChI=1S/C16H27N5O3S/c1-12-11-14-15(16(17)18-12)19-13(2)21(14)7-9-24-8-3-5-20-6-4-10-25(20,22)23/h11,22-23H,3-10H2,1-2H3,(H2,17,18) |
| InChIKey | NZBYAZFMEGKVEZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|