C18H23N5O3S — CID 23450084
1-[2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]ethyl]-2-methylimidazo[4,5-c]quinolin-4-amine (PubChem CID 23450084) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-[2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]ethyl]-2-methylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]ethyl]-2-methylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 23450084 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]ethyl]-2-methylimidazo[4,5-c]quinolin-4-amine |
| SMILES | Cc1nc2c(N)nc3ccccc3c2n1CCOCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C18H23N5O3S/c1-13-20-16-17(14-5-2-3-6-15(14)21-18(16)19)23(13)9-11-26-10-8-22-7-4-12-27(22,24)25/h2-3,5-6H,4,7-12H2,1H3,(H2,19,21) |
| InChIKey | RPKGWDSIRXYWCM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|