C18H17FNO3- — CID 6919422
(2S)-4-(4-fluoroanilino)-4-oxo-2-[(1R)-1-phenylethyl]butanoate (PubChem CID 6919422) has the molecular formula C18H17FNO3- and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S)-4-(4-fluoroanilino)-4-oxo-2-[(1R)-1-phenylethyl]butanoate.
| Compound Name | (2S)-4-(4-fluoroanilino)-4-oxo-2-[(1R)-1-phenylethyl]butanoate |
|---|---|
| PubChem CID | 6919422 |
| Molecular Formula | C18H17FNO3- |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2S)-4-(4-fluoroanilino)-4-oxo-2-[(1R)-1-phenylethyl]butanoate |
| SMILES | C[C@@H](c1ccccc1)[C@H](CC(=O)Nc1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C18H18FNO3/c1-12(13-5-3-2-4-6-13)16(18(22)23)11-17(21)20-15-9-7-14(19)8-10-15/h2-10,12,16H,11H2,1H3,(H,20,21)(H,22,23)/p-1/t12-,16-/m0/s1 |
| InChIKey | UAJHBFHNGNEZJR-LRDDRELGSA-M |
| XLogP | 2.32 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |