C40H40N2O7S — CID 69202354
benzyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]-2,6-dimethylphenyl]benzoate (PubChem CID 69202354) has the molecular formula C40H40N2O7S and a molecular weight of 692.83 g/mol. Its IUPAC name is benzyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]-2,6-dimethylphenyl]benzoate.
| Compound Name | benzyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]-2,6-dimethylphenyl]benzoate |
|---|---|
| PubChem CID | 69202354 |
| Molecular Formula | C40H40N2O7S |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | benzyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]-2,6-dimethylphenyl]benzoate |
| SMILES | Cc1cc(OCCN[C@@H](C)[C@H](O)c2ccc3cc2NS(=O)(=O)c2cccc(c2)CO3)cc(C)c1-c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40N2O7S/c1-26-20-34(21-27(2)38(26)31-12-14-32(15-13-31)40(44)49-24-29-8-5-4-6-9-29)47-19-18-41-28(3)39(43)36-17-16-33-23-37(36)42-50(45,46)35-11-7-10-30(22-35)25-48-33/h4-17,20-23,28,39,41-43H,18-19,24-25H2,1-3H3/t28-,39-/m0/s1 |
| InChIKey | ORPAUXMVEPDPKS-IMSFFZSHSA-N |
| XLogP | 7.11 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|