C15H17BrO5 — CID 69203791
ethyl 4-(7-bromo-1,3-benzodioxol-4-yl)-4-methyl-2-oxopentanoate (PubChem CID 69203791) has the molecular formula C15H17BrO5 and a molecular weight of 357.20 g/mol. Its IUPAC name is ethyl 4-(7-bromo-1,3-benzodioxol-4-yl)-4-methyl-2-oxopentanoate.
| Compound Name | ethyl 4-(7-bromo-1,3-benzodioxol-4-yl)-4-methyl-2-oxopentanoate |
|---|---|
| PubChem CID | 69203791 |
| Molecular Formula | C15H17BrO5 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | ethyl 4-(7-bromo-1,3-benzodioxol-4-yl)-4-methyl-2-oxopentanoate |
| SMILES | CCOC(=O)C(=O)CC(C)(C)c1ccc(Br)c2c1OCO2 |
| InChI | InChI=1S/C15H17BrO5/c1-4-19-14(18)11(17)7-15(2,3)9-5-6-10(16)13-12(9)20-8-21-13/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | NGQWNAOMXVYKON-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|