C8H10O5 — CID 123706574
ethyl 3-(1,3-dioxol-4-yl)-2-oxopropanoate (PubChem CID 123706574) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is ethyl 3-(1,3-dioxol-4-yl)-2-oxopropanoate.
| Compound Name | ethyl 3-(1,3-dioxol-4-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 123706574 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | ethyl 3-(1,3-dioxol-4-yl)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)CC1=COCO1 |
| InChI | InChI=1S/C8H10O5/c1-2-12-8(10)7(9)3-6-4-11-5-13-6/h4H,2-3,5H2,1H3 |
| InChIKey | XYIPGUWHCWKGOO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|