C12H19NO4S2 — CID 101441266
O-ethyl [tert-butyl(1,3-dioxol-4-ylmethyl)carbamoyl]sulfanylmethanethioate (PubChem CID 101441266) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is O-ethyl [tert-butyl(1,3-dioxol-4-ylmethyl)carbamoyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [tert-butyl(1,3-dioxol-4-ylmethyl)carbamoyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 101441266 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | O-ethyl [tert-butyl(1,3-dioxol-4-ylmethyl)carbamoyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(=O)N(CC1=COCO1)C(C)(C)C |
| InChI | InChI=1S/C12H19NO4S2/c1-5-16-11(18)19-10(14)13(12(2,3)4)6-9-7-15-8-17-9/h7H,5-6,8H2,1-4H3 |
| InChIKey | ALTILCZBSPLEKM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|