C32H37N5O3 — CID 69204658
(2,6-dimethylphenyl) N-[2-[4-[2-(dimethylamino)ethoxy]anilino]-3-phenylpropyl]-N-pyrimidin-4-ylcarbamate (PubChem CID 69204658) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-[2-[4-[2-(dimethylamino)ethoxy]anilino]-3-phenylpropyl]-N-pyrimidin-4-ylcarbamate.
| Compound Name | (2,6-dimethylphenyl) N-[2-[4-[2-(dimethylamino)ethoxy]anilino]-3-phenylpropyl]-N-pyrimidin-4-ylcarbamate |
|---|---|
| PubChem CID | 69204658 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | (2,6-dimethylphenyl) N-[2-[4-[2-(dimethylamino)ethoxy]anilino]-3-phenylpropyl]-N-pyrimidin-4-ylcarbamate |
| SMILES | Cc1cccc(C)c1OC(=O)N(CC(Cc1ccccc1)Nc1ccc(OCCN(C)C)cc1)c1ccncn1 |
| InChI | InChI=1S/C32H37N5O3/c1-24-9-8-10-25(2)31(24)40-32(38)37(30-17-18-33-23-34-30)22-28(21-26-11-6-5-7-12-26)35-27-13-15-29(16-14-27)39-20-19-36(3)4/h5-18,23,28,35H,19-22H2,1-4H3 |
| InChIKey | PCQAYAHFKQRWKI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|