C31H33F2N5O4 — CID 91555994
[2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl] N-[2-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)carbamate (PubChem CID 91555994) has the molecular formula C31H33F2N5O4 and a molecular weight of 577.63 g/mol. Its IUPAC name is [2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl] N-[2-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl] N-[2-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 91555994 |
| Molecular Formula | C31H33F2N5O4 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl] N-[2-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)carbamate |
| SMILES | Cc1cccc(C)c1N(C(=O)Oc1ccnc(Nc2ccc(OCCCN(C)C)cc2)n1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C31H33F2N5O4/c1-21-9-7-10-22(2)28(21)38(25-11-5-6-12-26(25)41-29(32)33)31(39)42-27-17-18-34-30(36-27)35-23-13-15-24(16-14-23)40-20-8-19-37(3)4/h5-7,9-18,29H,8,19-20H2,1-4H3,(H,34,35,36) |
| InChIKey | PMMSVUVXGIIXER-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|