C31H35N5O5 — CID 87732969
(2,6-dimethylphenyl) N-[2-[2-(4-aminophenoxy)ethyl-methylamino]pyrimidin-4-yl]-N-[(2,5-dimethoxyphenyl)methyl]carbamate (PubChem CID 87732969) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-[2-[2-(4-aminophenoxy)ethyl-methylamino]pyrimidin-4-yl]-N-[(2,5-dimethoxyphenyl)methyl]carbamate.
| Compound Name | (2,6-dimethylphenyl) N-[2-[2-(4-aminophenoxy)ethyl-methylamino]pyrimidin-4-yl]-N-[(2,5-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 87732969 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (2,6-dimethylphenyl) N-[2-[2-(4-aminophenoxy)ethyl-methylamino]pyrimidin-4-yl]-N-[(2,5-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(OC)c(CN(C(=O)Oc2c(C)cccc2C)c2ccnc(N(C)CCOc3ccc(N)cc3)n2)c1 |
| InChI | InChI=1S/C31H35N5O5/c1-21-7-6-8-22(2)29(21)41-31(37)36(20-23-19-26(38-4)13-14-27(23)39-5)28-15-16-33-30(34-28)35(3)17-18-40-25-11-9-24(32)10-12-25/h6-16,19H,17-18,20,32H2,1-5H3 |
| InChIKey | IUGANWXCVFFVSK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|