C20H22ClN4O2+ — CID 69208308
1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-cyclohexylpyrazol-1-ium-1-carboxamide (PubChem CID 69208308) has the molecular formula C20H22ClN4O2+ and a molecular weight of 385.88 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-cyclohexylpyrazol-1-ium-1-carboxamide.
| Compound Name | 1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-cyclohexylpyrazol-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 69208308 |
| Molecular Formula | C20H22ClN4O2+ |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-cyclohexylpyrazol-1-ium-1-carboxamide |
| SMILES | Cc1onc(-c2ccc(Cl)cc2)c1[N+]1(C(=O)NC2CCCCC2)C=CC=N1 |
| InChI | InChI=1S/C20H21ClN4O2/c1-14-19(18(24-27-14)15-8-10-16(21)11-9-15)25(13-5-12-22-25)20(26)23-17-6-3-2-4-7-17/h5,8-13,17H,2-4,6-7H2,1H3/p+1 |
| InChIKey | RFGLHBJNKUJNFM-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|