C13H28NO+ — CID 6921143
(3R,5R)-1,5-ditert-butylpiperidin-1-ium-3-ol (PubChem CID 6921143) has the molecular formula C13H28NO+ and a molecular weight of 214.37 g/mol. Its IUPAC name is (3R,5R)-1,5-ditert-butylpiperidin-1-ium-3-ol.
| Compound Name | (3R,5R)-1,5-ditert-butylpiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 6921143 |
| Molecular Formula | C13H28NO+ |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | (3R,5R)-1,5-ditert-butylpiperidin-1-ium-3-ol |
| SMILES | CC(C)(C)[C@H]1C[C@@H](O)C[NH+](C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27NO/c1-12(2,3)10-7-11(15)9-14(8-10)13(4,5)6/h10-11,15H,7-9H2,1-6H3/p+1/t10-,11+/m0/s1 |
| InChIKey | SXCPSDUKJOOIEW-WDEREUQCSA-O |
| XLogP | 1.10 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |