C18H20F2N4OS — CID 69214338
2-[4-(11,12-difluoro-5-methyl-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl)piperazin-2-yl]ethanol (PubChem CID 69214338) has the molecular formula C18H20F2N4OS and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[4-(11,12-difluoro-5-methyl-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-(11,12-difluoro-5-methyl-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 69214338 |
| Molecular Formula | C18H20F2N4OS |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[4-(11,12-difluoro-5-methyl-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl)piperazin-2-yl]ethanol |
| SMILES | Cc1cc2c(s1)NC=c1c(F)c(F)cnc1=C2N1CCNC(CCO)C1 |
| InChI | InChI=1S/C18H20F2N4OS/c1-10-6-12-17(24-4-3-21-11(9-24)2-5-25)16-13(7-23-18(12)26-10)15(20)14(19)8-22-16/h6-8,11,21,23,25H,2-5,9H2,1H3 |
| InChIKey | PCZQLWBLAOWYNG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |