C24H27N5S — CID 69489910
5-methyl-2-[4-methyl-3-(2-pyridin-4-ylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene (PubChem CID 69489910) has the molecular formula C24H27N5S and a molecular weight of 417.58 g/mol. Its IUPAC name is 5-methyl-2-[4-methyl-3-(2-pyridin-4-ylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene.
| Compound Name | 5-methyl-2-[4-methyl-3-(2-pyridin-4-ylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 69489910 |
| Molecular Formula | C24H27N5S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 5-methyl-2-[4-methyl-3-(2-pyridin-4-ylethyl)piperazin-1-yl]-6-thia-8,14-diazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
| SMILES | Cc1cc2c(s1)NC=c1cccnc1=C2N1CCN(C)C(CCc2ccncc2)C1 |
| InChI | InChI=1S/C24H27N5S/c1-17-14-21-23(22-19(4-3-9-26-22)15-27-24(21)30-17)29-13-12-28(2)20(16-29)6-5-18-7-10-25-11-8-18/h3-4,7-11,14-15,20,27H,5-6,12-13,16H2,1-2H3 |
| InChIKey | INISRDXXXBZGOM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |