C21H26F3N5OS — CID 69214039
2-[3-(2-methoxyethyl)-4-propylpiperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene (PubChem CID 69214039) has the molecular formula C21H26F3N5OS and a molecular weight of 453.53 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-4-propylpiperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene.
| Compound Name | 2-[3-(2-methoxyethyl)-4-propylpiperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 69214039 |
| Molecular Formula | C21H26F3N5OS |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[3-(2-methoxyethyl)-4-propylpiperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
| SMILES | CCCN1CCN(C2=c3ncccc3=CNc3sc(C(F)(F)F)nc32)CC1CCOC |
| InChI | InChI=1S/C21H26F3N5OS/c1-3-8-28-9-10-29(13-15(28)6-11-30-2)18-16-14(5-4-7-25-16)12-26-19-17(18)27-20(31-19)21(22,23)24/h4-5,7,12,15,26H,3,6,8-11,13H2,1-2H3 |
| InChIKey | KIPISHYMSBKXOW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |