C20H24F3N5OS — CID 69211659
2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(3,3,3-trifluoropropyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene (PubChem CID 69211659) has the molecular formula C20H24F3N5OS and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(3,3,3-trifluoropropyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene.
| Compound Name | 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(3,3,3-trifluoropropyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 69211659 |
| Molecular Formula | C20H24F3N5OS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(3,3,3-trifluoropropyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
| SMILES | COCCC1CN(C2=c3ncccc3=CNc3sc(CCC(F)(F)F)nc32)CCN1 |
| InChI | InChI=1S/C20H24F3N5OS/c1-29-10-5-14-12-28(9-8-24-14)18-16-13(3-2-7-25-16)11-26-19-17(18)27-15(30-19)4-6-20(21,22)23/h2-3,7,11,14,24,26H,4-6,8-10,12H2,1H3 |
| InChIKey | ZKDIMCDFNOIKFE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |