C17H20N4OS2 — CID 87885500
8-[3-(2-methoxyethyl)piperazin-1-yl]-3,4-dithia-6,10-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene (PubChem CID 87885500) has the molecular formula C17H20N4OS2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 8-[3-(2-methoxyethyl)piperazin-1-yl]-3,4-dithia-6,10-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene.
| Compound Name | 8-[3-(2-methoxyethyl)piperazin-1-yl]-3,4-dithia-6,10-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene |
|---|---|
| PubChem CID | 87885500 |
| Molecular Formula | C17H20N4OS2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 8-[3-(2-methoxyethyl)piperazin-1-yl]-3,4-dithia-6,10-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene |
| SMILES | COCCC1CN(c2c3nccccc-3c3c2N=CSS3)CCN1 |
| InChI | InChI=1S/C17H20N4OS2/c1-22-9-5-12-10-21(8-7-18-12)16-14-13(4-2-3-6-19-14)17-15(16)20-11-23-24-17/h2-4,6,11-12,18H,5,7-10H2,1H3 |
| InChIKey | IBHBJWXBBCBHAR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|