C18H20F3N5OS — CID 69214282
2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene (PubChem CID 69214282) has the molecular formula C18H20F3N5OS and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene.
| Compound Name | 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 69214282 |
| Molecular Formula | C18H20F3N5OS |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[3-(2-methoxyethyl)piperazin-1-yl]-5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
| SMILES | COCCC1CN(C2=c3ncccc3=CNc3sc(C(F)(F)F)nc32)CCN1 |
| InChI | InChI=1S/C18H20F3N5OS/c1-27-8-4-12-10-26(7-6-22-12)15-13-11(3-2-5-23-13)9-24-16-14(15)25-17(28-16)18(19,20)21/h2-3,5,9,12,22,24H,4,6-8,10H2,1H3 |
| InChIKey | ZZRNNGWEXMIEGI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |