C25H29N5S — CID 69486957
2-[3-(2-phenylethyl)piperazin-1-yl]-5-propan-2-yl-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene (PubChem CID 69486957) has the molecular formula C25H29N5S and a molecular weight of 431.61 g/mol. Its IUPAC name is 2-[3-(2-phenylethyl)piperazin-1-yl]-5-propan-2-yl-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene.
| Compound Name | 2-[3-(2-phenylethyl)piperazin-1-yl]-5-propan-2-yl-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 69486957 |
| Molecular Formula | C25H29N5S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[3-(2-phenylethyl)piperazin-1-yl]-5-propan-2-yl-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaene |
| SMILES | CC(C)c1nc2c(s1)NC=c1cccnc1=C2N1CCNC(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H29N5S/c1-17(2)24-29-22-23(21-19(9-6-12-27-21)15-28-25(22)31-24)30-14-13-26-20(16-30)11-10-18-7-4-3-5-8-18/h3-9,12,15,17,20,26,28H,10-11,13-14,16H2,1-2H3 |
| InChIKey | ANZUCSSGTDUVFM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |