C27H34O3 — CID 69214967
methyl 4-[(E)-3-(4,4-dimethyl-2,3-dihydrochromen-7-yl)oct-1-enyl]benzoate (PubChem CID 69214967) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is methyl 4-[(E)-3-(4,4-dimethyl-2,3-dihydrochromen-7-yl)oct-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-(4,4-dimethyl-2,3-dihydrochromen-7-yl)oct-1-enyl]benzoate |
|---|---|
| PubChem CID | 69214967 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | methyl 4-[(E)-3-(4,4-dimethyl-2,3-dihydrochromen-7-yl)oct-1-enyl]benzoate |
| SMILES | CCCCCC(/C=C/c1ccc(C(=O)OC)cc1)c1ccc2c(c1)OCCC2(C)C |
| InChI | InChI=1S/C27H34O3/c1-5-6-7-8-21(12-9-20-10-13-22(14-11-20)26(28)29-4)23-15-16-24-25(19-23)30-18-17-27(24,2)3/h9-16,19,21H,5-8,17-18H2,1-4H3/b12-9+ |
| InChIKey | IOTHMEIBWTYYTC-FMIVXFBMSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|