C15H20N2O2Sn — CID 69222485
3-[1-(4-trimethylstannylphenyl)ethyl]imidazole-4-carboxylic acid (PubChem CID 69222485) has the molecular formula C15H20N2O2Sn and a molecular weight of 379.05 g/mol. Its IUPAC name is 3-[1-(4-trimethylstannylphenyl)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 3-[1-(4-trimethylstannylphenyl)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 69222485 |
| Molecular Formula | C15H20N2O2Sn |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-[1-(4-trimethylstannylphenyl)ethyl]imidazole-4-carboxylic acid |
| SMILES | CC(c1ccc([Sn](C)(C)C)cc1)n1cncc1C(=O)O |
| InChI | InChI=1S/C12H11N2O2.3CH3.Sn/c1-9(10-5-3-2-4-6-10)14-8-13-7-11(14)12(15)16;;;;/h3-9H,1H3,(H,15,16);3*1H3; |
| InChIKey | BPQUCZJDMUBCGK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |