C14H16N2O4 — CID 138505747
3-[1-(3,5-dimethoxyphenyl)ethyl]imidazole-4-carboxylic acid (PubChem CID 138505747) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-[1-(3,5-dimethoxyphenyl)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 3-[1-(3,5-dimethoxyphenyl)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 138505747 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[1-(3,5-dimethoxyphenyl)ethyl]imidazole-4-carboxylic acid |
| SMILES | COc1cc(OC)cc(C(C)n2cncc2C(=O)O)c1 |
| InChI | InChI=1S/C14H16N2O4/c1-9(16-8-15-7-13(16)14(17)18)10-4-11(19-2)6-12(5-10)20-3/h4-9H,1-3H3,(H,17,18) |
| InChIKey | LXACIEBSRWLVEH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |