C29H33ClN6S2 — CID 69226910
2-ethyl-8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]thiazolo[4,5-i][3]benzazepine;hydrochloride (PubChem CID 69226910) has the molecular formula C29H33ClN6S2 and a molecular weight of 565.21 g/mol. Its IUPAC name is 2-ethyl-8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]thiazolo[4,5-i][3]benzazepine;hydrochloride.
| Compound Name | 2-ethyl-8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]thiazolo[4,5-i][3]benzazepine;hydrochloride |
|---|---|
| PubChem CID | 69226910 |
| Molecular Formula | C29H33ClN6S2 |
| Molecular Weight | 565.21 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 2-ethyl-8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-6,7,9,10-tetrahydro-[1,3]thiazolo[4,5-i][3]benzazepine;hydrochloride |
| SMILES | CCc1nc2ccc3c(c2s1)CCN(CCCSc1nnc(-c2cccc4nc(C)ccc24)n1C)CC3.Cl |
| InChI | InChI=1S/C29H32N6S2.ClH/c1-4-26-31-25-12-10-20-13-16-35(17-14-21(20)27(25)37-26)15-6-18-36-29-33-32-28(34(29)3)23-7-5-8-24-22(23)11-9-19(2)30-24;/h5,7-12H,4,6,13-18H2,1-3H3;1H |
| InChIKey | UNFMQNFAGLCLHW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.21 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|