C20H20N5O2+ — CID 69229186
1,3,7-trimethyl-8-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]purine-2,6-dione (PubChem CID 69229186) has the molecular formula C20H20N5O2+ and a molecular weight of 362.41 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]purine-2,6-dione |
|---|---|
| PubChem CID | 69229186 |
| Molecular Formula | C20H20N5O2+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1,3,7-trimethyl-8-[2-(1-methylquinolin-1-ium-2-yl)ethenyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(C=Cc3ccc4ccccc4[n+]3C)n2C)n(C)c1=O |
| InChI | InChI=1S/C20H20N5O2/c1-22-14(10-9-13-7-5-6-8-15(13)22)11-12-16-21-18-17(23(16)2)19(26)25(4)20(27)24(18)3/h5-12H,1-4H3/q+1 |
| InChIKey | VVMVRIDWJURQMJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|