C24H31ClN2O4S — CID 69229200
6-[5-[2-(3-chlorophenyl)ethylamino]pentanoyl]-2,2-dimethyl-3,4-dihydrochromene-8-sulfonamide (PubChem CID 69229200) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is 6-[5-[2-(3-chlorophenyl)ethylamino]pentanoyl]-2,2-dimethyl-3,4-dihydrochromene-8-sulfonamide.
| Compound Name | 6-[5-[2-(3-chlorophenyl)ethylamino]pentanoyl]-2,2-dimethyl-3,4-dihydrochromene-8-sulfonamide |
|---|---|
| PubChem CID | 69229200 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[5-[2-(3-chlorophenyl)ethylamino]pentanoyl]-2,2-dimethyl-3,4-dihydrochromene-8-sulfonamide |
| SMILES | CC1(C)CCc2cc(C(=O)CCCCNCCc3cccc(Cl)c3)cc(S(N)(=O)=O)c2O1 |
| InChI | InChI=1S/C24H31ClN2O4S/c1-24(2)11-9-18-15-19(16-22(23(18)31-24)32(26,29)30)21(28)8-3-4-12-27-13-10-17-6-5-7-20(25)14-17/h5-7,14-16,27H,3-4,8-13H2,1-2H3,(H2,26,29,30) |
| InChIKey | WPRVOIYHZCACTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|