C52H89N5O4 — CID 69230118
5-amino-1-[(2R,3R,4R,5R)-5-[(benzylamino)methyl]-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]imidazole-4-carboxamide (PubChem CID 69230118) has the molecular formula C52H89N5O4 and a molecular weight of 848.31 g/mol. Its IUPAC name is 5-amino-1-[(2R,3R,4R,5R)-5-[(benzylamino)methyl]-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]imidazole-4-carboxamide.
| Compound Name | 5-amino-1-[(2R,3R,4R,5R)-5-[(benzylamino)methyl]-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 69230118 |
| Molecular Formula | C52H89N5O4 |
| Molecular Weight | 848.31 g/mol |
| Exact Mass | 847.69 |
| IUPAC Name | 5-amino-1-[(2R,3R,4R,5R)-5-[(benzylamino)methyl]-3,4-bis[(Z)-octadec-9-enoxy]oxolan-2-yl]imidazole-4-carboxamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO[C@@H]1[C@H](OCCCCCCCC/C=C\CCCCCCCC)[C@@H](CNCc2ccccc2)O[C@H]1n1cnc(C(N)=O)c1N |
| InChI | InChI=1S/C52H89N5O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-40-59-48-46(43-55-42-45-38-34-33-35-39-45)61-52(57-44-56-47(50(57)53)51(54)58)49(48)60-41-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,33-35,38-39,44,46,48-49,52,55H,3-16,21-32,36-37,40-43,53H2,1-2H3,(H2,54,58)/b19-17-,20-18-/t46-,48-,49-,52-/m1/s1 |
| InChIKey | SXWPEBSMPJTRPL-RWKIRQJXSA-N |
| XLogP | 13.10 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.31 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|