C25H33NO5 — CID 69231776
tert-butyl 3-[2-(1-amino-2-oxo-2-propan-2-yloxyethyl)-5-phenylmethoxyphenyl]propanoate (PubChem CID 69231776) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl 3-[2-(1-amino-2-oxo-2-propan-2-yloxyethyl)-5-phenylmethoxyphenyl]propanoate.
| Compound Name | tert-butyl 3-[2-(1-amino-2-oxo-2-propan-2-yloxyethyl)-5-phenylmethoxyphenyl]propanoate |
|---|---|
| PubChem CID | 69231776 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | tert-butyl 3-[2-(1-amino-2-oxo-2-propan-2-yloxyethyl)-5-phenylmethoxyphenyl]propanoate |
| SMILES | CC(C)OC(=O)C(N)c1ccc(OCc2ccccc2)cc1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33NO5/c1-17(2)30-24(28)23(26)21-13-12-20(29-16-18-9-7-6-8-10-18)15-19(21)11-14-22(27)31-25(3,4)5/h6-10,12-13,15,17,23H,11,14,16,26H2,1-5H3 |
| InChIKey | XYYOUEDJIBQDMW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |