C21H25F3N2O4 — CID 69233855
1,4-dimethyl-5-[4-(3-morpholin-4-ylpropoxy)-2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid (PubChem CID 69233855) has the molecular formula C21H25F3N2O4 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1,4-dimethyl-5-[4-(3-morpholin-4-ylpropoxy)-2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid.
| Compound Name | 1,4-dimethyl-5-[4-(3-morpholin-4-ylpropoxy)-2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69233855 |
| Molecular Formula | C21H25F3N2O4 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1,4-dimethyl-5-[4-(3-morpholin-4-ylpropoxy)-2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cn(C)c1-c1ccc(OCCCN2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H25F3N2O4/c1-14-17(20(27)28)13-25(2)19(14)16-5-4-15(12-18(16)21(22,23)24)30-9-3-6-26-7-10-29-11-8-26/h4-5,12-13H,3,6-11H2,1-2H3,(H,27,28) |
| InChIKey | IGIKWAWANFSJJK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|