C25H33IN2O4Si — CID 69236993
5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxy-1-iodoethyl]-8-[(4-methoxyphenyl)methoxy]-1H-quinolin-2-one (PubChem CID 69236993) has the molecular formula C25H33IN2O4Si and a molecular weight of 580.54 g/mol. Its IUPAC name is 5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxy-1-iodoethyl]-8-[(4-methoxyphenyl)methoxy]-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxy-1-iodoethyl]-8-[(4-methoxyphenyl)methoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 69236993 |
| Molecular Formula | C25H33IN2O4Si |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 5-[(1R)-2-amino-1-[tert-butyl(dimethyl)silyl]oxy-1-iodoethyl]-8-[(4-methoxyphenyl)methoxy]-1H-quinolin-2-one |
| SMILES | COc1ccc(COc2ccc([C@@](I)(CN)O[Si](C)(C)C(C)(C)C)c3ccc(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C25H33IN2O4Si/c1-24(2,3)33(5,6)32-25(26,16-27)20-12-13-21(23-19(20)11-14-22(29)28-23)31-15-17-7-9-18(30-4)10-8-17/h7-14H,15-16,27H2,1-6H3,(H,28,29)/t25-/m1/s1 |
| InChIKey | RWIWAFKIXFEANT-RUZDIDTESA-N |
| XLogP | 5.68 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|