C16H12BrNO3 — CID 6923935
(3Z)-5-bromo-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 6923935) has the molecular formula C16H12BrNO3 and a molecular weight of 346.18 g/mol. Its IUPAC name is (3Z)-5-bromo-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-bromo-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 6923935 |
| Molecular Formula | C16H12BrNO3 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (3Z)-5-bromo-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccc(/C=C2\C(=O)Nc3ccc(Br)cc32)cc1O |
| InChI | InChI=1S/C16H12BrNO3/c1-21-15-5-2-9(7-14(15)19)6-12-11-8-10(17)3-4-13(11)18-16(12)20/h2-8,19H,1H3,(H,18,20)/b12-6- |
| InChIKey | HNVLUJVVOQZYMT-SDQBBNPISA-N |
| XLogP | 3.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|