C9H13N3O3 — CID 6924062
5-[[(2S)-butan-2-yl]iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 6924062) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-[[(2S)-butan-2-yl]iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[(2S)-butan-2-yl]iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6924062 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-[[(2S)-butan-2-yl]iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC[C@H](C)/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C9H13N3O3/c1-3-5(2)10-4-6-7(13)11-9(15)12-8(6)14/h4-6H,3H2,1-2H3,(H2,11,12,13,14,15)/b10-4+/t5-/m0/s1 |
| InChIKey | CXBPAMQGOHJIBO-PKLKZBOMSA-N |
| XLogP | -0.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|