C16H15Cl2HgNaO3S — CID 69252203
sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury;(2,4-dichlorophenyl)methanol (PubChem CID 69252203) has the molecular formula C16H15Cl2HgNaO3S and a molecular weight of 581.85 g/mol. Its IUPAC name is sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury;(2,4-dichlorophenyl)methanol.
| Compound Name | sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury;(2,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 69252203 |
| Molecular Formula | C16H15Cl2HgNaO3S |
| Molecular Weight | 581.85 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury;(2,4-dichlorophenyl)methanol |
| SMILES | CC[Hg]Sc1ccccc1C(=O)[O-].OCc1ccc(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C7H6Cl2O.C7H6O2S.C2H5.Hg.Na/c8-6-2-1-5(4-10)7(9)3-6;8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-3,10H,4H2;1-4,10H,(H,8,9);1H2,2H3;;/q;;;2*+1/p-2 |
| InChIKey | RPTKYULFJYJIRV-UHFFFAOYSA-L |
| XLogP | 1.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.85 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|