C11H11N4O2- — CID 6926315
(3R)-3-phenyl-4-(tetrazol-1-yl)butanoate (PubChem CID 6926315) has the molecular formula C11H11N4O2- and a molecular weight of 231.24 g/mol. Its IUPAC name is (3R)-3-phenyl-4-(tetrazol-1-yl)butanoate.
| Compound Name | (3R)-3-phenyl-4-(tetrazol-1-yl)butanoate |
|---|---|
| PubChem CID | 6926315 |
| Molecular Formula | C11H11N4O2- |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3R)-3-phenyl-4-(tetrazol-1-yl)butanoate |
| SMILES | O=C([O-])C[C@@H](Cn1cnnn1)c1ccccc1 |
| InChI | InChI=1S/C11H12N4O2/c16-11(17)6-10(7-15-8-12-13-14-15)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,16,17)/p-1/t10-/m0/s1 |
| InChIKey | BXRQAQUJNCMHOC-JTQLQIEISA-M |
| XLogP | -0.40 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |