C22H32BrF3N2O2 — CID 69263633
2-[3-bromo-5-(trifluoromethyl)-2-pyridinyl]-N-[[4-[2-[(2S)-oxan-2-yl]oxyethyl]cyclohexyl]methyl]ethanamine (PubChem CID 69263633) has the molecular formula C22H32BrF3N2O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is 2-[3-bromo-5-(trifluoromethyl)-2-pyridinyl]-N-[[4-[2-[(2S)-oxan-2-yl]oxyethyl]cyclohexyl]methyl]ethanamine.
| Compound Name | 2-[3-bromo-5-(trifluoromethyl)-2-pyridinyl]-N-[[4-[2-[(2S)-oxan-2-yl]oxyethyl]cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 69263633 |
| Molecular Formula | C22H32BrF3N2O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[3-bromo-5-(trifluoromethyl)-2-pyridinyl]-N-[[4-[2-[(2S)-oxan-2-yl]oxyethyl]cyclohexyl]methyl]ethanamine |
| SMILES | FC(F)(F)c1cnc(CCNCC2CCC(CCO[C@H]3CCCCO3)CC2)c(Br)c1 |
| InChI | InChI=1S/C22H32BrF3N2O2/c23-19-13-18(22(24,25)26)15-28-20(19)8-10-27-14-17-6-4-16(5-7-17)9-12-30-21-3-1-2-11-29-21/h13,15-17,21,27H,1-12,14H2/t16?,17?,21-/m0/s1 |
| InChIKey | POBVCYXMXUIUED-BPZDKFOGSA-N |
| XLogP | 5.73 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|