C16H17N2O5+ — CID 6926951
1,3-benzodioxol-5-ylmethyl-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]azanium (PubChem CID 6926951) has the molecular formula C16H17N2O5+ and a molecular weight of 317.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 6926951 |
| Molecular Formula | C16H17N2O5+ |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]azanium |
| SMILES | O=[N+]([O-])c1cccc([C@@H](O)C[NH2+]Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H16N2O5/c19-14(12-2-1-3-13(7-12)18(20)21)9-17-8-11-4-5-15-16(6-11)23-10-22-15/h1-7,14,17,19H,8-10H2/p+1/t14-/m0/s1 |
| InChIKey | CWYOKCMZZUYCEO-AWEZNQCLSA-O |
| XLogP | 1.12 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|